C10H10N2NaO2 — CID 131869061
CID 131869061 (PubChem CID 131869061) has the molecular formula C10H10N2NaO2 and a molecular weight of 213.19 g/mol.
| Compound Name | CID 131869061 |
|---|---|
| PubChem CID | 131869061 |
| Molecular Formula | C10H10N2NaO2 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | — |
| SMILES | O=C(O)N1N=CCC1c1ccccc1.[Na] |
| InChI | InChI=1S/C10H10N2O2.Na/c13-10(14)12-9(6-7-11-12)8-4-2-1-3-5-8;/h1-5,7,9H,6H2,(H,13,14); |
| InChIKey | NCJRGKLOWIMARM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |