C7H10N4O4 — CID 143577562
1-(2,5-dioxopyrrolidin-1-yl)-3-(methylcarbamoyl)urea (PubChem CID 143577562) has the molecular formula C7H10N4O4 and a molecular weight of 214.18 g/mol. Its IUPAC name is 1-(2,5-dioxopyrrolidin-1-yl)-3-(methylcarbamoyl)urea.
| Compound Name | 1-(2,5-dioxopyrrolidin-1-yl)-3-(methylcarbamoyl)urea |
|---|---|
| PubChem CID | 143577562 |
| Molecular Formula | C7H10N4O4 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 1-(2,5-dioxopyrrolidin-1-yl)-3-(methylcarbamoyl)urea |
| SMILES | CNC(=O)NC(=O)NN1C(=O)CCC1=O |
| InChI | InChI=1S/C7H10N4O4/c1-8-6(14)9-7(15)10-11-4(12)2-3-5(11)13/h2-3H2,1H3,(H3,8,9,10,14,15) |
| InChIKey | NXLYWVJFBINQLV-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|