C8H12N2O3 — CID 89079228
1-[3-(methylamino)-2-oxopropyl]pyrrolidine-2,5-dione (PubChem CID 89079228) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is 1-[3-(methylamino)-2-oxopropyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[3-(methylamino)-2-oxopropyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 89079228 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 1-[3-(methylamino)-2-oxopropyl]pyrrolidine-2,5-dione |
| SMILES | CNCC(=O)CN1C(=O)CCC1=O |
| InChI | InChI=1S/C8H12N2O3/c1-9-4-6(11)5-10-7(12)2-3-8(10)13/h9H,2-5H2,1H3 |
| InChIKey | BANTXJXECYQADO-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|