About ethane;1-(3-oxopentyl)pyrrolidine-2,5-dione
ethane;1-(3-oxopentyl)pyrrolidine-2,5-dione (PubChem CID 145339436) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is ethane;1-(3-oxopentyl)pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | ethane;1-(3-oxopentyl)pyrrolidine-2,5-dione |
| PubChem CID | 145339436 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | ethane;1-(3-oxopentyl)pyrrolidine-2,5-dione |
| SMILES | CC.CCC(=O)CCN1C(=O)CCC1=O |
| InChI | InChI=1S/C9H13NO3.C2H6/c1-2-7(11)5-6-10-8(12)3-4-9(10)13;1-2/h2-6H2,1H3;1-2H3 |
| InChIKey | LPXLVXFIGMWJJC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(3-oxopentyl)pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(3-oxopentyl)pyrrolidine-2,5-dione?
The IUPAC name of ethane;1-(3-oxopentyl)pyrrolidine-2,5-dione (CID 145339436) is ethane;1-(3-oxopentyl)pyrrolidine-2,5-dione.
What is the SMILES notation for ethane;1-(3-oxopentyl)pyrrolidine-2,5-dione?
The canonical SMILES for ethane;1-(3-oxopentyl)pyrrolidine-2,5-dione is CC.CCC(=O)CCN1C(=O)CCC1=O.
What is the InChIKey of ethane;1-(3-oxopentyl)pyrrolidine-2,5-dione?
The InChIKey is LPXLVXFIGMWJJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3.C2H6/c1-2-7(11)5-6-10-8(12)3-4-9(10)13;1-2/h2-6H2,1H3;1-2H3.
What are the key properties of ethane;1-(3-oxopentyl)pyrrolidine-2,5-dione?
ethane;1-(3-oxopentyl)pyrrolidine-2,5-dione has a molecular weight of 213.28 g/mol, XLogP of 1.53, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(3-oxopentyl)pyrrolidine-2,5-dione is sourced from PubChem (CID 145339436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).