C7H10N2O2S — CID 24709121
3-(2,5-dioxopyrrolidin-1-yl)propanethioamide (PubChem CID 24709121) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)propanethioamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)propanethioamide |
|---|---|
| PubChem CID | 24709121 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)propanethioamide |
| SMILES | NC(=S)CCN1C(=O)CCC1=O |
| InChI | InChI=1S/C7H10N2O2S/c8-5(12)3-4-9-6(10)1-2-7(9)11/h1-4H2,(H2,8,12) |
| InChIKey | UVGQLTUZBUIPIK-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|