About 3-(2,5-dioxopyrrolidin-1-yl)propanethioamide
3-(2,5-dioxopyrrolidin-1-yl)propanethioamide (PubChem CID 24709121) has the molecular formula C7H10N2O2S
and a molecular weight of 186.24 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)propanethioamide.
Molecular Properties
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)propanethioamide |
| PubChem CID | 24709121 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)propanethioamide |
| SMILES | NC(=S)CCN1C(=O)CCC1=O |
| InChI | InChI=1S/C7H10N2O2S/c8-5(12)3-4-9-6(10)1-2-7(9)11/h1-4H2,(H2,8,12) |
| InChIKey | UVGQLTUZBUIPIK-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dioxopyrrolidin-1-yl)propanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dioxopyrrolidin-1-yl)propanethioamide?
The IUPAC name of 3-(2,5-dioxopyrrolidin-1-yl)propanethioamide (CID 24709121) is 3-(2,5-dioxopyrrolidin-1-yl)propanethioamide.
What is the SMILES notation for 3-(2,5-dioxopyrrolidin-1-yl)propanethioamide?
The canonical SMILES for 3-(2,5-dioxopyrrolidin-1-yl)propanethioamide is NC(=S)CCN1C(=O)CCC1=O.
What is the InChIKey of 3-(2,5-dioxopyrrolidin-1-yl)propanethioamide?
The InChIKey is UVGQLTUZBUIPIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S/c8-5(12)3-4-9-6(10)1-2-7(9)11/h1-4H2,(H2,8,12).
What are the key properties of 3-(2,5-dioxopyrrolidin-1-yl)propanethioamide?
3-(2,5-dioxopyrrolidin-1-yl)propanethioamide has a molecular weight of 186.24 g/mol, XLogP of -0.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dioxopyrrolidin-1-yl)propanethioamide is sourced from PubChem (CID 24709121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).