C12H20N2O4 — CID 113339384
3-(2,5-dioxopyrrolidin-1-yl)-N-ethyl-N-(3-hydroxypropyl)propanamide (PubChem CID 113339384) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-N-ethyl-N-(3-hydroxypropyl)propanamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-ethyl-N-(3-hydroxypropyl)propanamide |
|---|---|
| PubChem CID | 113339384 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-ethyl-N-(3-hydroxypropyl)propanamide |
| SMILES | CCN(CCCO)C(=O)CCN1C(=O)CCC1=O |
| InChI | InChI=1S/C12H20N2O4/c1-2-13(7-3-9-15)10(16)6-8-14-11(17)4-5-12(14)18/h15H,2-9H2,1H3 |
| InChIKey | GWXVKNIYKLKAQC-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|