C10H15BrN2O3 — CID 167362911
1-[4-(2-bromoethylamino)-2-oxobutyl]pyrrolidine-2,5-dione (PubChem CID 167362911) has the molecular formula C10H15BrN2O3 and a molecular weight of 291.15 g/mol. Its IUPAC name is 1-[4-(2-bromoethylamino)-2-oxobutyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-(2-bromoethylamino)-2-oxobutyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 167362911 |
| Molecular Formula | C10H15BrN2O3 |
| Molecular Weight | 291.15 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 1-[4-(2-bromoethylamino)-2-oxobutyl]pyrrolidine-2,5-dione |
| SMILES | O=C(CCNCCBr)CN1C(=O)CCC1=O |
| InChI | InChI=1S/C10H15BrN2O3/c11-4-6-12-5-3-8(14)7-13-9(15)1-2-10(13)16/h12H,1-7H2 |
| InChIKey | DXOMWTCVZYRDRZ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.15 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|