C20H24N2O10 — CID 118359817
4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-[2-[5-(2-methylidene-5-oxopyrrolidin-1-yl)-4-oxopentanoyl]oxyethyl] butanedioate (PubChem CID 118359817) has the molecular formula C20H24N2O10 and a molecular weight of 452.42 g/mol. Its IUPAC name is 4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-[2-[5-(2-methylidene-5-oxopyrrolidin-1-yl)-4-oxopentanoyl]oxyethyl] butanedioate.
| Compound Name | 4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-[2-[5-(2-methylidene-5-oxopyrrolidin-1-yl)-4-oxopentanoyl]oxyethyl] butanedioate |
|---|---|
| PubChem CID | 118359817 |
| Molecular Formula | C20H24N2O10 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-[2-[5-(2-methylidene-5-oxopyrrolidin-1-yl)-4-oxopentanoyl]oxyethyl] butanedioate |
| SMILES | C=C1CCC(=O)N1CC(=O)CCC(=O)OCCOC(=O)CCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C20H24N2O10/c1-13-2-4-15(24)21(13)12-14(23)3-7-18(27)30-10-11-31-19(28)8-9-20(29)32-22-16(25)5-6-17(22)26/h1-12H2 |
| InChIKey | YQGLFSNMSGTSKA-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 153.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|