C5H8N2O3 — CID 134473437
1-(methoxyamino)pyrrolidine-2,5-dione (PubChem CID 134473437) has the molecular formula C5H8N2O3 and a molecular weight of 144.13 g/mol. Its IUPAC name is 1-(methoxyamino)pyrrolidine-2,5-dione.
| Compound Name | 1-(methoxyamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 134473437 |
| Molecular Formula | C5H8N2O3 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | 1-(methoxyamino)pyrrolidine-2,5-dione |
| SMILES | CONN1C(=O)CCC1=O |
| InChI | InChI=1S/C5H8N2O3/c1-10-6-7-4(8)2-3-5(7)9/h6H,2-3H2,1H3 |
| InChIKey | MYWOKYIMVJIMIA-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|