C5H6N2O4 — CID 89105288
[(2,5-dioxopyrrolidin-1-yl)amino] formate (PubChem CID 89105288) has the molecular formula C5H6N2O4 and a molecular weight of 158.11 g/mol. Its IUPAC name is [(2,5-dioxopyrrolidin-1-yl)amino] formate.
| Compound Name | [(2,5-dioxopyrrolidin-1-yl)amino] formate |
|---|---|
| PubChem CID | 89105288 |
| Molecular Formula | C5H6N2O4 |
| Molecular Weight | 158.11 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | [(2,5-dioxopyrrolidin-1-yl)amino] formate |
| SMILES | O=CONN1C(=O)CCC1=O |
| InChI | InChI=1S/C5H6N2O4/c8-3-11-6-7-4(9)1-2-5(7)10/h3,6H,1-2H2 |
| InChIKey | XPQVKYXLECKVSJ-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.11 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|