C7H9NO4 — CID 173415580
1-(2,5-dioxopyrrolidin-1-yl)ethyl formate (PubChem CID 173415580) has the molecular formula C7H9NO4 and a molecular weight of 171.15 g/mol. Its IUPAC name is 1-(2,5-dioxopyrrolidin-1-yl)ethyl formate.
| Compound Name | 1-(2,5-dioxopyrrolidin-1-yl)ethyl formate |
|---|---|
| PubChem CID | 173415580 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 1-(2,5-dioxopyrrolidin-1-yl)ethyl formate |
| SMILES | CC(OC=O)N1C(=O)CCC1=O |
| InChI | InChI=1S/C7H9NO4/c1-5(12-4-9)8-6(10)2-3-7(8)11/h4-5H,2-3H2,1H3 |
| InChIKey | UAJOZAXCNQMROL-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|