About 1-(2,5-dioxopyrrolidin-1-yl)ethyl formate
1-(2,5-dioxopyrrolidin-1-yl)ethyl formate (PubChem CID 173415580) has the molecular formula C7H9NO4
and a molecular weight of 171.15 g/mol. Its IUPAC name is 1-(2,5-dioxopyrrolidin-1-yl)ethyl formate.
Molecular Properties
| Compound Name | 1-(2,5-dioxopyrrolidin-1-yl)ethyl formate |
| PubChem CID | 173415580 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 1-(2,5-dioxopyrrolidin-1-yl)ethyl formate |
| SMILES | CC(OC=O)N1C(=O)CCC1=O |
| InChI | InChI=1S/C7H9NO4/c1-5(12-4-9)8-6(10)2-3-7(8)11/h4-5H,2-3H2,1H3 |
| InChIKey | UAJOZAXCNQMROL-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,5-dioxopyrrolidin-1-yl)ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dioxopyrrolidin-1-yl)ethyl formate?
The IUPAC name of 1-(2,5-dioxopyrrolidin-1-yl)ethyl formate (CID 173415580) is 1-(2,5-dioxopyrrolidin-1-yl)ethyl formate.
What is the SMILES notation for 1-(2,5-dioxopyrrolidin-1-yl)ethyl formate?
The canonical SMILES for 1-(2,5-dioxopyrrolidin-1-yl)ethyl formate is CC(OC=O)N1C(=O)CCC1=O.
What is the InChIKey of 1-(2,5-dioxopyrrolidin-1-yl)ethyl formate?
The InChIKey is UAJOZAXCNQMROL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO4/c1-5(12-4-9)8-6(10)2-3-7(8)11/h4-5H,2-3H2,1H3.
What are the key properties of 1-(2,5-dioxopyrrolidin-1-yl)ethyl formate?
1-(2,5-dioxopyrrolidin-1-yl)ethyl formate has a molecular weight of 171.15 g/mol, XLogP of -0.35, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dioxopyrrolidin-1-yl)ethyl formate is sourced from PubChem (CID 173415580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).