C10H17NO3 — CID 24975057
1-(1-butoxyethyl)pyrrolidine-2,5-dione (PubChem CID 24975057) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 1-(1-butoxyethyl)pyrrolidine-2,5-dione.
| Compound Name | 1-(1-butoxyethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 24975057 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 1-(1-butoxyethyl)pyrrolidine-2,5-dione |
| SMILES | CCCCOC(C)N1C(=O)CCC1=O |
| InChI | InChI=1S/C10H17NO3/c1-3-4-7-14-8(2)11-9(12)5-6-10(11)13/h8H,3-7H2,1-2H3 |
| InChIKey | AEBILLASRTYMTQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|