C8H15N3O — CID 40535397
4-[(1R)-1-butoxyethyl]-1,2,4-triazole (PubChem CID 40535397) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 4-[(1R)-1-butoxyethyl]-1,2,4-triazole.
| Compound Name | 4-[(1R)-1-butoxyethyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 40535397 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 4-[(1R)-1-butoxyethyl]-1,2,4-triazole |
| SMILES | CCCCO[C@H](C)n1cnnc1 |
| InChI | InChI=1S/C8H15N3O/c1-3-4-5-12-8(2)11-6-9-10-7-11/h6-8H,3-5H2,1-2H3/t8-/m1/s1 |
| InChIKey | CDFAHNFXMAVYNW-MRVPVSSYSA-N |
| XLogP | 1.61 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|