C11H21N3O — CID 10036067
(2S,3R)-3-(1,2,4-triazol-4-yl)nonan-2-ol (PubChem CID 10036067) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is (2S,3R)-3-(1,2,4-triazol-4-yl)nonan-2-ol.
| Compound Name | (2S,3R)-3-(1,2,4-triazol-4-yl)nonan-2-ol |
|---|---|
| PubChem CID | 10036067 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | (2S,3R)-3-(1,2,4-triazol-4-yl)nonan-2-ol |
| SMILES | CCCCCC[C@H]([C@H](C)O)n1cnnc1 |
| InChI | InChI=1S/C11H21N3O/c1-3-4-5-6-7-11(10(2)15)14-8-12-13-9-14/h8-11,15H,3-7H2,1-2H3/t10-,11+/m0/s1 |
| InChIKey | DXYLKUYBUZJUSZ-WDEREUQCSA-N |
| XLogP | 2.17 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|