C14H25N3O3 — CID 102328422
ethyl 1-[(2S,3R)-2-hydroxynonan-3-yl]-1,2,4-triazole-3-carboxylate (PubChem CID 102328422) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is ethyl 1-[(2S,3R)-2-hydroxynonan-3-yl]-1,2,4-triazole-3-carboxylate.
| Compound Name | ethyl 1-[(2S,3R)-2-hydroxynonan-3-yl]-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 102328422 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | ethyl 1-[(2S,3R)-2-hydroxynonan-3-yl]-1,2,4-triazole-3-carboxylate |
| SMILES | CCCCCC[C@H]([C@H](C)O)n1cnc(C(=O)OCC)n1 |
| InChI | InChI=1S/C14H25N3O3/c1-4-6-7-8-9-12(11(3)18)17-10-15-13(16-17)14(19)20-5-2/h10-12,18H,4-9H2,1-3H3/t11-,12+/m0/s1 |
| InChIKey | AHEHBSAAXOQHIK-NWDGAFQWSA-N |
| XLogP | 2.35 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|