About 1-(2-methylazetidin-1-yl)ethyl formate;hydrochloride
1-(2-methylazetidin-1-yl)ethyl formate;hydrochloride (PubChem CID 174706430) has the molecular formula C7H14ClNO2
and a molecular weight of 179.65 g/mol. Its IUPAC name is 1-(2-methylazetidin-1-yl)ethyl formate;hydrochloride.
Molecular Properties
| Compound Name | 1-(2-methylazetidin-1-yl)ethyl formate;hydrochloride |
| PubChem CID | 174706430 |
| Molecular Formula | C7H14ClNO2 |
| Molecular Weight | 179.65 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 1-(2-methylazetidin-1-yl)ethyl formate;hydrochloride |
| SMILES | CC1CCN1C(C)OC=O.Cl |
| InChI | InChI=1S/C7H13NO2.ClH/c1-6-3-4-8(6)7(2)10-5-9;/h5-7H,3-4H2,1-2H3;1H |
| InChIKey | XYIOVDHUIXRHDA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.65 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methylazetidin-1-yl)ethyl formate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylazetidin-1-yl)ethyl formate;hydrochloride?
The IUPAC name of 1-(2-methylazetidin-1-yl)ethyl formate;hydrochloride (CID 174706430) is 1-(2-methylazetidin-1-yl)ethyl formate;hydrochloride.
What is the SMILES notation for 1-(2-methylazetidin-1-yl)ethyl formate;hydrochloride?
The canonical SMILES for 1-(2-methylazetidin-1-yl)ethyl formate;hydrochloride is CC1CCN1C(C)OC=O.Cl.
What is the InChIKey of 1-(2-methylazetidin-1-yl)ethyl formate;hydrochloride?
The InChIKey is XYIOVDHUIXRHDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.ClH/c1-6-3-4-8(6)7(2)10-5-9;/h5-7H,3-4H2,1-2H3;1H.
What are the key properties of 1-(2-methylazetidin-1-yl)ethyl formate;hydrochloride?
1-(2-methylazetidin-1-yl)ethyl formate;hydrochloride has a molecular weight of 179.65 g/mol, XLogP of 1.02, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylazetidin-1-yl)ethyl formate;hydrochloride is sourced from PubChem (CID 174706430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).