C13H27N3O — CID 159863431
1,3,4,7,10-pentamethyl-1,3,7-triazecane-2-carbaldehyde (PubChem CID 159863431) has the molecular formula C13H27N3O and a molecular weight of 241.38 g/mol. Its IUPAC name is 1,3,4,7,10-pentamethyl-1,3,7-triazecane-2-carbaldehyde.
| Compound Name | 1,3,4,7,10-pentamethyl-1,3,7-triazecane-2-carbaldehyde |
|---|---|
| PubChem CID | 159863431 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 1,3,4,7,10-pentamethyl-1,3,7-triazecane-2-carbaldehyde |
| SMILES | CC1CCN(C)CCC(C)N(C)C(C=O)N1C |
| InChI | InChI=1S/C13H27N3O/c1-11-6-8-14(3)9-7-12(2)16(5)13(10-17)15(11)4/h10-13H,6-9H2,1-5H3 |
| InChIKey | IVFGYXSOQBQPQB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|