C12H13N3O3 — CID 19047182
bicyclo[3.1.0]hexa-1(6),2,4-triene;(2,6-dioxopiperidin-1-yl)urea (PubChem CID 19047182) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;(2,6-dioxopiperidin-1-yl)urea.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;(2,6-dioxopiperidin-1-yl)urea |
|---|---|
| PubChem CID | 19047182 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;(2,6-dioxopiperidin-1-yl)urea |
| SMILES | NC(=O)NN1C(=O)CCCC1=O.c1cc2cc-2c1 |
| InChI | InChI=1S/C6H9N3O3.C6H4/c7-6(12)8-9-4(10)2-1-3-5(9)11;1-2-5-4-6(5)3-1/h1-3H2,(H3,7,8,12);1-4H |
| InChIKey | ZZSDPFJVEXYDOX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|