About (2-oxoazepan-1-yl)urea
(2-oxoazepan-1-yl)urea (PubChem CID 67625281) has the molecular formula C7H13N3O2
and a molecular weight of 171.20 g/mol. Its IUPAC name is (2-oxoazepan-1-yl)urea.
Molecular Properties
| Compound Name | (2-oxoazepan-1-yl)urea |
| PubChem CID | 67625281 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | (2-oxoazepan-1-yl)urea |
| SMILES | NC(=O)NN1CCCCCC1=O |
| InChI | InChI=1S/C7H13N3O2/c8-7(12)9-10-5-3-1-2-4-6(10)11/h1-5H2,(H3,8,9,12) |
| InChIKey | QFVVUKRCSOCHPO-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-oxoazepan-1-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxoazepan-1-yl)urea?
The IUPAC name of (2-oxoazepan-1-yl)urea (CID 67625281) is (2-oxoazepan-1-yl)urea.
What is the SMILES notation for (2-oxoazepan-1-yl)urea?
The canonical SMILES for (2-oxoazepan-1-yl)urea is NC(=O)NN1CCCCCC1=O.
What is the InChIKey of (2-oxoazepan-1-yl)urea?
The InChIKey is QFVVUKRCSOCHPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O2/c8-7(12)9-10-5-3-1-2-4-6(10)11/h1-5H2,(H3,8,9,12).
What are the key properties of (2-oxoazepan-1-yl)urea?
(2-oxoazepan-1-yl)urea has a molecular weight of 171.20 g/mol, XLogP of -0.03, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxoazepan-1-yl)urea is sourced from PubChem (CID 67625281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).