C14H19N5O2 — CID 166186141
N-(2-oxopiperidin-1-yl)-2-pyrrolidin-1-ylpyrimidine-4-carboxamide (PubChem CID 166186141) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is N-(2-oxopiperidin-1-yl)-2-pyrrolidin-1-ylpyrimidine-4-carboxamide.
| Compound Name | N-(2-oxopiperidin-1-yl)-2-pyrrolidin-1-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 166186141 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N-(2-oxopiperidin-1-yl)-2-pyrrolidin-1-ylpyrimidine-4-carboxamide |
| SMILES | O=C(NN1CCCCC1=O)c1ccnc(N2CCCC2)n1 |
| InChI | InChI=1S/C14H19N5O2/c20-12-5-1-2-10-19(12)17-13(21)11-6-7-15-14(16-11)18-8-3-4-9-18/h6-7H,1-5,8-10H2,(H,17,21) |
| InChIKey | PUIASEKITKBUAU-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |