C12H14N2O7S2 — CID 87689094
sulfo 3-[[1-(2,5-dioxopyrrolidin-1-yl)-2H-pyridin-2-yl]sulfanyl]propanoate (PubChem CID 87689094) has the molecular formula C12H14N2O7S2 and a molecular weight of 362.39 g/mol. Its IUPAC name is sulfo 3-[[1-(2,5-dioxopyrrolidin-1-yl)-2H-pyridin-2-yl]sulfanyl]propanoate.
| Compound Name | sulfo 3-[[1-(2,5-dioxopyrrolidin-1-yl)-2H-pyridin-2-yl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 87689094 |
| Molecular Formula | C12H14N2O7S2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | sulfo 3-[[1-(2,5-dioxopyrrolidin-1-yl)-2H-pyridin-2-yl]sulfanyl]propanoate |
| SMILES | O=C(CCSC1C=CC=CN1N1C(=O)CCC1=O)OS(=O)(=O)O |
| InChI | InChI=1S/C12H14N2O7S2/c15-9-4-5-10(16)14(9)13-7-2-1-3-11(13)22-8-6-12(17)21-23(18,19)20/h1-3,7,11H,4-6,8H2,(H,18,19,20) |
| InChIKey | UQPSRDCUCKZRDW-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|