C12H14N2O4S2 — CID 88715775
3-[[1-(2,5-dioxopyrrolidin-1-yl)-2H-pyridin-3-yl]disulfanyl]propanoic acid (PubChem CID 88715775) has the molecular formula C12H14N2O4S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-[[1-(2,5-dioxopyrrolidin-1-yl)-2H-pyridin-3-yl]disulfanyl]propanoic acid.
| Compound Name | 3-[[1-(2,5-dioxopyrrolidin-1-yl)-2H-pyridin-3-yl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 88715775 |
| Molecular Formula | C12H14N2O4S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 3-[[1-(2,5-dioxopyrrolidin-1-yl)-2H-pyridin-3-yl]disulfanyl]propanoic acid |
| SMILES | O=C(O)CCSSC1=CC=CN(N2C(=O)CCC2=O)C1 |
| InChI | InChI=1S/C12H14N2O4S2/c15-10-3-4-11(16)14(10)13-6-1-2-9(8-13)20-19-7-5-12(17)18/h1-2,6H,3-5,7-8H2,(H,17,18) |
| InChIKey | AZRKASHTJHMUME-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|