C17H24N2O4S2 — CID 88596464
7-[[1-(2,5-dioxopyrrolidin-1-yl)-2H-pyridin-2-yl]disulfanyl]octanoic acid (PubChem CID 88596464) has the molecular formula C17H24N2O4S2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 7-[[1-(2,5-dioxopyrrolidin-1-yl)-2H-pyridin-2-yl]disulfanyl]octanoic acid.
| Compound Name | 7-[[1-(2,5-dioxopyrrolidin-1-yl)-2H-pyridin-2-yl]disulfanyl]octanoic acid |
|---|---|
| PubChem CID | 88596464 |
| Molecular Formula | C17H24N2O4S2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 7-[[1-(2,5-dioxopyrrolidin-1-yl)-2H-pyridin-2-yl]disulfanyl]octanoic acid |
| SMILES | CC(CCCCCC(=O)O)SSC1C=CC=CN1N1C(=O)CCC1=O |
| InChI | InChI=1S/C17H24N2O4S2/c1-13(7-3-2-4-9-17(22)23)24-25-16-8-5-6-12-18(16)19-14(20)10-11-15(19)21/h5-6,8,12-13,16H,2-4,7,9-11H2,1H3,(H,22,23) |
| InChIKey | DAZXZPBYBAMSGM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|