C14H18N2O4S — CID 159413263
[1-(2,5-dioxopyrrolidin-1-yl)-2H-pyridin-2-yl]sulfanyl pentanoate (PubChem CID 159413263) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is [1-(2,5-dioxopyrrolidin-1-yl)-2H-pyridin-2-yl]sulfanyl pentanoate.
| Compound Name | [1-(2,5-dioxopyrrolidin-1-yl)-2H-pyridin-2-yl]sulfanyl pentanoate |
|---|---|
| PubChem CID | 159413263 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | [1-(2,5-dioxopyrrolidin-1-yl)-2H-pyridin-2-yl]sulfanyl pentanoate |
| SMILES | CCCCC(=O)OSC1C=CC=CN1N1C(=O)CCC1=O |
| InChI | InChI=1S/C14H18N2O4S/c1-2-3-7-14(19)20-21-13-6-4-5-10-15(13)16-11(17)8-9-12(16)18/h4-6,10,13H,2-3,7-9H2,1H3 |
| InChIKey | LOVOQGLFKJVPOQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|