C17H20N2O9 — CID 90373293
1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxybutyl 4-(2,5-dioxopyrrol-1-yl)butanoate (PubChem CID 90373293) has the molecular formula C17H20N2O9 and a molecular weight of 396.35 g/mol. Its IUPAC name is 1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxybutyl 4-(2,5-dioxopyrrol-1-yl)butanoate.
| Compound Name | 1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxybutyl 4-(2,5-dioxopyrrol-1-yl)butanoate |
|---|---|
| PubChem CID | 90373293 |
| Molecular Formula | C17H20N2O9 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 1-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxybutyl 4-(2,5-dioxopyrrol-1-yl)butanoate |
| SMILES | CCCC(OC(=O)CCCN1C(=O)C=CC1=O)OC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C17H20N2O9/c1-2-4-16(27-17(25)28-19-13(22)8-9-14(19)23)26-15(24)5-3-10-18-11(20)6-7-12(18)21/h6-7,16H,2-5,8-10H2,1H3 |
| InChIKey | VHYFXUIGYJESPK-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 136.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|