C28H33N3O10 — CID 90373545
[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-phenylmethyl] 6-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]hexanoate (PubChem CID 90373545) has the molecular formula C28H33N3O10 and a molecular weight of 571.58 g/mol. Its IUPAC name is [(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-phenylmethyl] 6-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]hexanoate.
| Compound Name | [(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-phenylmethyl] 6-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]hexanoate |
|---|---|
| PubChem CID | 90373545 |
| Molecular Formula | C28H33N3O10 |
| Molecular Weight | 571.58 g/mol |
| Exact Mass | 571.22 |
| IUPAC Name | [(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxy-phenylmethyl] 6-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]hexanoate |
| SMILES | O=C(CCCCCN1C(=O)C=CC1=O)NCCCCCC(=O)OC(OC(=O)ON1C(=O)CCC1=O)c1ccccc1 |
| InChI | InChI=1S/C28H33N3O10/c32-21(12-6-3-9-19-30-22(33)14-15-23(30)34)29-18-8-2-7-13-26(37)39-27(20-10-4-1-5-11-20)40-28(38)41-31-24(35)16-17-25(31)36/h1,4-5,10-11,14-15,27H,2-3,6-9,12-13,16-19H2,(H,29,32) |
| InChIKey | CIJIRLCBNWEBJC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.58 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|