C22H36N4O5 — CID 18724284
6-[6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoylamino]-N-ethylhexanamide (PubChem CID 18724284) has the molecular formula C22H36N4O5 and a molecular weight of 436.55 g/mol. Its IUPAC name is 6-[6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoylamino]-N-ethylhexanamide.
| Compound Name | 6-[6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoylamino]-N-ethylhexanamide |
|---|---|
| PubChem CID | 18724284 |
| Molecular Formula | C22H36N4O5 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | 6-[6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]hexanoylamino]-N-ethylhexanamide |
| SMILES | CCNC(=O)CCCCCNC(=O)CCCCCNC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C22H36N4O5/c1-2-23-18(27)10-5-3-7-15-24-19(28)11-6-4-8-16-25-20(29)12-9-17-26-21(30)13-14-22(26)31/h13-14H,2-12,15-17H2,1H3,(H,23,27)(H,24,28)(H,25,29) |
| InChIKey | LBWLZJQBGYDAQD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|