C18H30N2O3 — CID 145076872
6-(2,5-dioxopyrrol-1-yl)-N-(5-methylheptyl)hexanamide (PubChem CID 145076872) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N-(5-methylheptyl)hexanamide.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N-(5-methylheptyl)hexanamide |
|---|---|
| PubChem CID | 145076872 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N-(5-methylheptyl)hexanamide |
| SMILES | CCC(C)CCCCNC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C18H30N2O3/c1-3-15(2)9-6-7-13-19-16(21)10-5-4-8-14-20-17(22)11-12-18(20)23/h11-12,15H,3-10,13-14H2,1-2H3,(H,19,21) |
| InChIKey | NNYQJQVOSRXWKJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|