C26H49N5O3 — CID 58654612
N-[(5R)-5-[bis[2-(diethylamino)ethyl]amino]hexyl]-4-(2,5-dioxopyrrol-1-yl)butanamide (PubChem CID 58654612) has the molecular formula C26H49N5O3 and a molecular weight of 479.71 g/mol. Its IUPAC name is N-[(5R)-5-[bis[2-(diethylamino)ethyl]amino]hexyl]-4-(2,5-dioxopyrrol-1-yl)butanamide.
| Compound Name | N-[(5R)-5-[bis[2-(diethylamino)ethyl]amino]hexyl]-4-(2,5-dioxopyrrol-1-yl)butanamide |
|---|---|
| PubChem CID | 58654612 |
| Molecular Formula | C26H49N5O3 |
| Molecular Weight | 479.71 g/mol |
| Exact Mass | 479.38 |
| IUPAC Name | N-[(5R)-5-[bis[2-(diethylamino)ethyl]amino]hexyl]-4-(2,5-dioxopyrrol-1-yl)butanamide |
| SMILES | CCN(CC)CCN(CCN(CC)CC)[C@H](C)CCCCNC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C26H49N5O3/c1-6-28(7-2)19-21-30(22-20-29(8-3)9-4)23(5)13-10-11-17-27-24(32)14-12-18-31-25(33)15-16-26(31)34/h15-16,23H,6-14,17-22H2,1-5H3,(H,27,32)/t23-/m1/s1 |
| InChIKey | IQWSKFRKZFLKLT-HSZRJFAPSA-N |
| XLogP | 2.35 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.71 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|