C20H32N4O4 — CID 176889453
6-(2,5-dioxopyrrol-1-yl)-N-(6-oxo-6-piperazin-1-ylhexyl)hexanamide (PubChem CID 176889453) has the molecular formula C20H32N4O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N-(6-oxo-6-piperazin-1-ylhexyl)hexanamide.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N-(6-oxo-6-piperazin-1-ylhexyl)hexanamide |
|---|---|
| PubChem CID | 176889453 |
| Molecular Formula | C20H32N4O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N-(6-oxo-6-piperazin-1-ylhexyl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)C=CC1=O)NCCCCCC(=O)N1CCNCC1 |
| InChI | InChI=1S/C20H32N4O4/c25-17(7-3-2-6-14-24-19(27)9-10-20(24)28)22-11-5-1-4-8-18(26)23-15-12-21-13-16-23/h9-10,21H,1-8,11-16H2,(H,22,25) |
| InChIKey | MWQVXGCOUWYKFA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|