C24H32F3N7O9 — CID 159713474
4-(2,5-dioxopyrrol-1-yl)-N-[2-oxo-2-[[2-oxo-2-[4-(2-oxo-2-piperazin-1-ylacetyl)piperazin-1-yl](1,2-13C2)ethyl]amino](1,2-13C2)ethyl]butan(15N)amide;2,2,2-trifluoroacetic acid (PubChem CID 159713474) has the molecular formula C24H32F3N7O9 and a molecular weight of 624.52 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)-N-[2-oxo-2-[[2-oxo-2-[4-(2-oxo-2-piperazin-1-ylacetyl)piperazin-1-yl](1,2-13C2)ethyl]amino](1,2-13C2)ethyl]butan(15N)amide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)-N-[2-oxo-2-[[2-oxo-2-[4-(2-oxo-2-piperazin-1-ylacetyl)piperazin-1-yl](1,2-13C2)ethyl]amino](1,2-13C2)ethyl]butan(15N)amide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 159713474 |
| Molecular Formula | C24H32F3N7O9 |
| Molecular Weight | 624.52 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)-N-[2-oxo-2-[[2-oxo-2-[4-(2-oxo-2-piperazin-1-ylacetyl)piperazin-1-yl](1,2-13C2)ethyl]amino](1,2-13C2)ethyl]butan(15N)amide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(CCCN1C(=O)C=CC1=O)[15NH][13CH2][13C](=O)N[13CH2][13C](=O)N1CCN(C(=O)C(=O)N2CCNCC2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H31N7O7.C2HF3O2/c30-16(2-1-7-29-18(32)3-4-19(29)33)24-14-17(31)25-15-20(34)26-10-12-28(13-11-26)22(36)21(35)27-8-5-23-6-9-27;3-2(4,5)1(6)7/h3-4,23H,1-2,5-15H2,(H,24,30)(H,25,31);(H,6,7)/i14+1,15+1,17+1,20+1,24+1; |
| InChIKey | GRPXUPSOTNGALM-SYWDFMFPSA-N |
| XLogP | -3.34 |
| TPSA | 205.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.52 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|