C20H29N5O8S — CID 177003187
6-[[[2-[[2-[[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]methylsulfanyl]hexanoic acid (PubChem CID 177003187) has the molecular formula C20H29N5O8S and a molecular weight of 499.55 g/mol. Its IUPAC name is 6-[[[2-[[2-[[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]methylsulfanyl]hexanoic acid.
| Compound Name | 6-[[[2-[[2-[[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]methylsulfanyl]hexanoic acid |
|---|---|
| PubChem CID | 177003187 |
| Molecular Formula | C20H29N5O8S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 6-[[[2-[[2-[[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]methylsulfanyl]hexanoic acid |
| SMILES | O=C(O)CCCCCSCNC(=O)CNC(=O)CNC(=O)CNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C20H29N5O8S/c26-14(7-8-25-18(30)5-6-19(25)31)21-10-15(27)22-11-16(28)23-12-17(29)24-13-34-9-3-1-2-4-20(32)33/h5-6H,1-4,7-13H2,(H,21,26)(H,22,27)(H,23,28)(H,24,29)(H,32,33) |
| InChIKey | MXVMMIBFAGMPNS-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 191.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|