C26H41N5O9S2 — CID 155716788
6-[[[2-[[2-[[2-[4-[2,5-dioxo-1-(4-oxopentyl)pyrrolidin-3-yl]sulfanylbutanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]methylsulfanyl]hexanoic acid (PubChem CID 155716788) has the molecular formula C26H41N5O9S2 and a molecular weight of 631.77 g/mol. Its IUPAC name is 6-[[[2-[[2-[[2-[4-[2,5-dioxo-1-(4-oxopentyl)pyrrolidin-3-yl]sulfanylbutanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]methylsulfanyl]hexanoic acid.
| Compound Name | 6-[[[2-[[2-[[2-[4-[2,5-dioxo-1-(4-oxopentyl)pyrrolidin-3-yl]sulfanylbutanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]methylsulfanyl]hexanoic acid |
|---|---|
| PubChem CID | 155716788 |
| Molecular Formula | C26H41N5O9S2 |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.23 |
| IUPAC Name | 6-[[[2-[[2-[[2-[4-[2,5-dioxo-1-(4-oxopentyl)pyrrolidin-3-yl]sulfanylbutanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]methylsulfanyl]hexanoic acid |
| SMILES | CC(=O)CCCN1C(=O)CC(SCCCC(=O)NCC(=O)NCC(=O)NCC(=O)NCSCCCCCC(=O)O)C1=O |
| InChI | InChI=1S/C26H41N5O9S2/c1-18(32)7-5-10-31-24(37)13-19(26(31)40)42-12-6-8-20(33)27-14-21(34)28-15-22(35)29-16-23(36)30-17-41-11-4-2-3-9-25(38)39/h19H,2-17H2,1H3,(H,27,33)(H,28,34)(H,29,35)(H,30,36)(H,38,39) |
| InChIKey | OCLWRUJODSRGGD-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 208.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|