C14H24N4O6S — CID 166157806
6-[[[2-[[2-[(2-formamidoacetyl)amino]acetyl]amino]acetyl]amino]methylsulfanyl]hexanoic acid (PubChem CID 166157806) has the molecular formula C14H24N4O6S and a molecular weight of 376.44 g/mol. Its IUPAC name is 6-[[[2-[[2-[(2-formamidoacetyl)amino]acetyl]amino]acetyl]amino]methylsulfanyl]hexanoic acid.
| Compound Name | 6-[[[2-[[2-[(2-formamidoacetyl)amino]acetyl]amino]acetyl]amino]methylsulfanyl]hexanoic acid |
|---|---|
| PubChem CID | 166157806 |
| Molecular Formula | C14H24N4O6S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 6-[[[2-[[2-[(2-formamidoacetyl)amino]acetyl]amino]acetyl]amino]methylsulfanyl]hexanoic acid |
| SMILES | O=CNCC(=O)NCC(=O)NCC(=O)NCSCCCCCC(=O)O |
| InChI | InChI=1S/C14H24N4O6S/c19-9-15-6-11(20)16-7-12(21)17-8-13(22)18-10-25-5-3-1-2-4-14(23)24/h9H,1-8,10H2,(H,15,19)(H,16,20)(H,17,21)(H,18,22)(H,23,24) |
| InChIKey | NUCVBIRNSYRHLJ-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 153.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|