C10H10N2O5 — CID 18523032
(2,5-dioxopyrrolidin-1-yl) N-(furan-2-yl)-N-methylcarbamate (PubChem CID 18523032) has the molecular formula C10H10N2O5 and a molecular weight of 238.20 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) N-(furan-2-yl)-N-methylcarbamate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) N-(furan-2-yl)-N-methylcarbamate |
|---|---|
| PubChem CID | 18523032 |
| Molecular Formula | C10H10N2O5 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) N-(furan-2-yl)-N-methylcarbamate |
| SMILES | CN(C(=O)ON1C(=O)CCC1=O)c1ccco1 |
| InChI | InChI=1S/C10H10N2O5/c1-11(9-3-2-6-16-9)10(15)17-12-7(13)4-5-8(12)14/h2-3,6H,4-5H2,1H3 |
| InChIKey | BNMYKKKXDLMDQK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|