C11H14N3NaO6S — CID 173246091
sodium;(1S,5R)-2-[furan-2-yl(methyl)carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid;hydride (PubChem CID 173246091) has the molecular formula C11H14N3NaO6S and a molecular weight of 339.31 g/mol. Its IUPAC name is sodium;(1S,5R)-2-[furan-2-yl(methyl)carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid;hydride.
| Compound Name | sodium;(1S,5R)-2-[furan-2-yl(methyl)carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173246091 |
| Molecular Formula | C11H14N3NaO6S |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | sodium;(1S,5R)-2-[furan-2-yl(methyl)carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid;hydride |
| SMILES | CN(C(=O)N1CC[C@@H]2[C@H]1C(=O)N2S(=O)(=O)O)c1ccco1.[H-].[Na+] |
| InChI | InChI=1S/C11H13N3O6S.Na.H/c1-12(8-3-2-6-20-8)11(16)13-5-4-7-9(13)10(15)14(7)21(17,18)19;;/h2-3,6-7,9H,4-5H2,1H3,(H,17,18,19);;/q;+1;-1/t7-,9+;;/m1../s1 |
| InChIKey | OOOWZFWTLZSPTF-ZQEGQHLZSA-N |
| XLogP | -2.96 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|