C17H22N4NaO7S — CID 67121309
CID 67121309 (PubChem CID 67121309) has the molecular formula C17H22N4NaO7S and a molecular weight of 449.44 g/mol.
| Compound Name | CID 67121309 |
|---|---|
| PubChem CID | 67121309 |
| Molecular Formula | C17H22N4NaO7S |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(NC(=O)N2CC[C@@H]3[C@H]2C(=O)N3S(=O)(=O)O)cc1.[Na] |
| InChI | InChI=1S/C17H22N4O7S.Na/c1-17(2,3)28-16(24)19-11-6-4-10(5-7-11)18-15(23)20-9-8-12-13(20)14(22)21(12)29(25,26)27;/h4-7,12-13H,8-9H2,1-3H3,(H,18,23)(H,19,24)(H,25,26,27);/t12-,13+;/m1./s1 |
| InChIKey | ZKKWXCBLHMPUBU-KZCZEQIWSA-N |
| XLogP | 1.27 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|