C12H15N4NaO5S — CID 173071027
sodium;(1S,5R)-2-[(4-aminophenyl)carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid;hydride (PubChem CID 173071027) has the molecular formula C12H15N4NaO5S and a molecular weight of 350.33 g/mol. Its IUPAC name is sodium;(1S,5R)-2-[(4-aminophenyl)carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid;hydride.
| Compound Name | sodium;(1S,5R)-2-[(4-aminophenyl)carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173071027 |
| Molecular Formula | C12H15N4NaO5S |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | sodium;(1S,5R)-2-[(4-aminophenyl)carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid;hydride |
| SMILES | Nc1ccc(NC(=O)N2CC[C@@H]3[C@H]2C(=O)N3S(=O)(=O)O)cc1.[H-].[Na+] |
| InChI | InChI=1S/C12H14N4O5S.Na.H/c13-7-1-3-8(4-2-7)14-12(18)15-6-5-9-10(15)11(17)16(9)22(19,20)21;;/h1-4,9-10H,5-6,13H2,(H,14,18)(H,19,20,21);;/q;+1;-1/t9-,10+;;/m1../s1 |
| InChIKey | PUZWQXVUFMONQM-NKRBYZSKSA-N |
| XLogP | -2.99 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|