C17H22N5NaO6S — CID 67121302
sodium (1S,5R)-2-[[4-[2-(dimethylamino)ethylcarbamoyl]phenyl]carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonate (PubChem CID 67121302) has the molecular formula C17H22N5NaO6S and a molecular weight of 447.45 g/mol. Its IUPAC name is sodium (1S,5R)-2-[[4-[2-(dimethylamino)ethylcarbamoyl]phenyl]carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonate.
| Compound Name | sodium (1S,5R)-2-[[4-[2-(dimethylamino)ethylcarbamoyl]phenyl]carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonate |
|---|---|
| PubChem CID | 67121302 |
| Molecular Formula | C17H22N5NaO6S |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | sodium (1S,5R)-2-[[4-[2-(dimethylamino)ethylcarbamoyl]phenyl]carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonate |
| SMILES | CN(C)CCNC(=O)c1ccc(NC(=O)N2CC[C@@H]3[C@H]2C(=O)N3S(=O)(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C17H23N5O6S.Na/c1-20(2)10-8-18-15(23)11-3-5-12(6-4-11)19-17(25)21-9-7-13-14(21)16(24)22(13)29(26,27)28;/h3-6,13-14H,7-10H2,1-2H3,(H,18,23)(H,19,25)(H,26,27,28);/q;+1/p-1/t13-,14+;/m1./s1 |
| InChIKey | QAJRSBSKDSAEJM-DFQHDRSWSA-M |
| XLogP | -3.74 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | -3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|