C13H14N3NaO5S — CID 70017197
sodium (1S,5R)-2-[(E)-3-(1-methylpyrrol-2-yl)prop-2-enoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonate (PubChem CID 70017197) has the molecular formula C13H14N3NaO5S and a molecular weight of 347.33 g/mol. Its IUPAC name is sodium (1S,5R)-2-[(E)-3-(1-methylpyrrol-2-yl)prop-2-enoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonate.
| Compound Name | sodium (1S,5R)-2-[(E)-3-(1-methylpyrrol-2-yl)prop-2-enoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonate |
|---|---|
| PubChem CID | 70017197 |
| Molecular Formula | C13H14N3NaO5S |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | sodium (1S,5R)-2-[(E)-3-(1-methylpyrrol-2-yl)prop-2-enoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonate |
| SMILES | Cn1cccc1/C=C/C(=O)N1CC[C@@H]2[C@H]1C(=O)N2S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C13H15N3O5S.Na/c1-14-7-2-3-9(14)4-5-11(17)15-8-6-10-12(15)13(18)16(10)22(19,20)21;/h2-5,7,10,12H,6,8H2,1H3,(H,19,20,21);/q;+1/p-1/b5-4+;/t10-,12+;/m1./s1 |
| InChIKey | OZISXRDPPKPNEY-TWEWYZQJSA-M |
| XLogP | -3.69 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|