C14H13N2NaO13S3 — CID 139980584
sodium (1S,5R)-2-[(E)-3-(3,4-disulfooxyphenyl)prop-2-enoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonate (PubChem CID 139980584) has the molecular formula C14H13N2NaO13S3 and a molecular weight of 536.45 g/mol. Its IUPAC name is sodium (1S,5R)-2-[(E)-3-(3,4-disulfooxyphenyl)prop-2-enoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonate.
| Compound Name | sodium (1S,5R)-2-[(E)-3-(3,4-disulfooxyphenyl)prop-2-enoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonate |
|---|---|
| PubChem CID | 139980584 |
| Molecular Formula | C14H13N2NaO13S3 |
| Molecular Weight | 536.45 g/mol |
| Exact Mass | 535.95 |
| IUPAC Name | sodium (1S,5R)-2-[(E)-3-(3,4-disulfooxyphenyl)prop-2-enoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonate |
| SMILES | O=C(/C=C/c1ccc(OS(=O)(=O)O)c(OS(=O)(=O)O)c1)N1CC[C@@H]2[C@H]1C(=O)N2S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C14H14N2O13S3.Na/c17-12(15-6-5-9-13(15)14(18)16(9)30(19,20)21)4-2-8-1-3-10(28-31(22,23)24)11(7-8)29-32(25,26)27;/h1-4,7,9,13H,5-6H2,(H,19,20,21)(H,22,23,24)(H,25,26,27);/q;+1/p-1/b4-2+;/t9-,13+;/m1./s1 |
| InChIKey | CNXURHFNOZBJLJ-UIFAIUFRSA-M |
| XLogP | -4.66 |
| TPSA | 225.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.45 |
| LogP ≤ 5 | -4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|