C14H23N5O6S — CID 71102552
(1S)-2-[[(4S)-1-(2-amino-2-oxoethyl)azepan-4-yl]carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid (PubChem CID 71102552) has the molecular formula C14H23N5O6S and a molecular weight of 389.43 g/mol. Its IUPAC name is (1S)-2-[[(4S)-1-(2-amino-2-oxoethyl)azepan-4-yl]carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid.
| Compound Name | (1S)-2-[[(4S)-1-(2-amino-2-oxoethyl)azepan-4-yl]carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid |
|---|---|
| PubChem CID | 71102552 |
| Molecular Formula | C14H23N5O6S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (1S)-2-[[(4S)-1-(2-amino-2-oxoethyl)azepan-4-yl]carbamoyl]-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid |
| SMILES | NC(=O)CN1CCC[C@H](NC(=O)N2CCC3[C@H]2C(=O)N3S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C14H23N5O6S/c15-11(20)8-17-5-1-2-9(3-6-17)16-14(22)18-7-4-10-12(18)13(21)19(10)26(23,24)25/h9-10,12H,1-8H2,(H2,15,20)(H,16,22)(H,23,24,25)/t9-,10?,12-/m0/s1 |
| InChIKey | PPKTUOJYLUIOER-VULFSTHESA-N |
| XLogP | -1.88 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|