C8H16BrN3O3S — CID 83084786
2-[4-(bromomethylsulfonylamino)piperidin-1-yl]acetamide (PubChem CID 83084786) has the molecular formula C8H16BrN3O3S and a molecular weight of 314.21 g/mol. Its IUPAC name is 2-[4-(bromomethylsulfonylamino)piperidin-1-yl]acetamide.
| Compound Name | 2-[4-(bromomethylsulfonylamino)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 83084786 |
| Molecular Formula | C8H16BrN3O3S |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 2-[4-(bromomethylsulfonylamino)piperidin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCC(NS(=O)(=O)CBr)CC1 |
| InChI | InChI=1S/C8H16BrN3O3S/c9-6-16(14,15)11-7-1-3-12(4-2-7)5-8(10)13/h7,11H,1-6H2,(H2,10,13) |
| InChIKey | ZIJJZLSIRIQHKJ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|