C13H17Cl2N3O3S — CID 86915412
2-[4-[(3,5-dichlorophenyl)sulfonylamino]piperidin-1-yl]acetamide (PubChem CID 86915412) has the molecular formula C13H17Cl2N3O3S and a molecular weight of 366.27 g/mol. Its IUPAC name is 2-[4-[(3,5-dichlorophenyl)sulfonylamino]piperidin-1-yl]acetamide.
| Compound Name | 2-[4-[(3,5-dichlorophenyl)sulfonylamino]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 86915412 |
| Molecular Formula | C13H17Cl2N3O3S |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 2-[4-[(3,5-dichlorophenyl)sulfonylamino]piperidin-1-yl]acetamide |
| SMILES | NC(=O)CN1CCC(NS(=O)(=O)c2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C13H17Cl2N3O3S/c14-9-5-10(15)7-12(6-9)22(20,21)17-11-1-3-18(4-2-11)8-13(16)19/h5-7,11,17H,1-4,8H2,(H2,16,19) |
| InChIKey | NHBQJNPXHXDEPP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |