C17H24N4O4S — CID 18278929
N-[1-(2-amino-2-oxoethyl)piperidin-4-yl]-4-(cyclopropylsulfamoyl)benzamide (PubChem CID 18278929) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is N-[1-(2-amino-2-oxoethyl)piperidin-4-yl]-4-(cyclopropylsulfamoyl)benzamide.
| Compound Name | N-[1-(2-amino-2-oxoethyl)piperidin-4-yl]-4-(cyclopropylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 18278929 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[1-(2-amino-2-oxoethyl)piperidin-4-yl]-4-(cyclopropylsulfamoyl)benzamide |
| SMILES | NC(=O)CN1CCC(NC(=O)c2ccc(S(=O)(=O)NC3CC3)cc2)CC1 |
| InChI | InChI=1S/C17H24N4O4S/c18-16(22)11-21-9-7-13(8-10-21)19-17(23)12-1-5-15(6-2-12)26(24,25)20-14-3-4-14/h1-2,5-6,13-14,20H,3-4,7-11H2,(H2,18,22)(H,19,23) |
| InChIKey | KFNBGVIBDCSIKW-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |