C7H15N3O — CID 74958986
2-[3-(methylamino)pyrrolidin-1-yl]acetamide (PubChem CID 74958986) has the molecular formula C7H15N3O and a molecular weight of 157.22 g/mol. Its IUPAC name is 2-[3-(methylamino)pyrrolidin-1-yl]acetamide.
| Compound Name | 2-[3-(methylamino)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 74958986 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | 2-[3-(methylamino)pyrrolidin-1-yl]acetamide |
| SMILES | CNC1CCN(CC(N)=O)C1 |
| InChI | InChI=1S/C7H15N3O/c1-9-6-2-3-10(4-6)5-7(8)11/h6,9H,2-5H2,1H3,(H2,8,11) |
| InChIKey | FASWRPILTWJOGX-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |