About 2-[(3R)-3-fluoropyrrolidin-1-yl]acetamide;2-methylpropane
2-[(3R)-3-fluoropyrrolidin-1-yl]acetamide;2-methylpropane (PubChem CID 162181974) has the molecular formula C10H21FN2O
and a molecular weight of 204.29 g/mol. Its IUPAC name is 2-[(3R)-3-fluoropyrrolidin-1-yl]acetamide;2-methylpropane.
Molecular Properties
| Compound Name | 2-[(3R)-3-fluoropyrrolidin-1-yl]acetamide;2-methylpropane |
| PubChem CID | 162181974 |
| Molecular Formula | C10H21FN2O |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 2-[(3R)-3-fluoropyrrolidin-1-yl]acetamide;2-methylpropane |
| SMILES | CC(C)C.NC(=O)CN1CC[C@@H](F)C1 |
| InChI | InChI=1S/C6H11FN2O.C4H10/c7-5-1-2-9(3-5)4-6(8)10;1-4(2)3/h5H,1-4H2,(H2,8,10);4H,1-3H3/t5-;/m1./s1 |
| InChIKey | ZPDMVNLIAYDEMH-NUBCRITNSA-N |
| XLogP | 1.18 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(3R)-3-fluoropyrrolidin-1-yl]acetamide;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R)-3-fluoropyrrolidin-1-yl]acetamide;2-methylpropane?
The IUPAC name of 2-[(3R)-3-fluoropyrrolidin-1-yl]acetamide;2-methylpropane (CID 162181974) is 2-[(3R)-3-fluoropyrrolidin-1-yl]acetamide;2-methylpropane.
What is the SMILES notation for 2-[(3R)-3-fluoropyrrolidin-1-yl]acetamide;2-methylpropane?
The canonical SMILES for 2-[(3R)-3-fluoropyrrolidin-1-yl]acetamide;2-methylpropane is CC(C)C.NC(=O)CN1CC[C@@H](F)C1.
What is the InChIKey of 2-[(3R)-3-fluoropyrrolidin-1-yl]acetamide;2-methylpropane?
The InChIKey is ZPDMVNLIAYDEMH-NUBCRITNSA-N. The full InChI is InChI=1S/C6H11FN2O.C4H10/c7-5-1-2-9(3-5)4-6(8)10;1-4(2)3/h5H,1-4H2,(H2,8,10);4H,1-3H3/t5-;/m1./s1.
What are the key properties of 2-[(3R)-3-fluoropyrrolidin-1-yl]acetamide;2-methylpropane?
2-[(3R)-3-fluoropyrrolidin-1-yl]acetamide;2-methylpropane has a molecular weight of 204.29 g/mol, XLogP of 1.18, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R)-3-fluoropyrrolidin-1-yl]acetamide;2-methylpropane is sourced from PubChem (CID 162181974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).