C10H21N5O3S — CID 104978488
2-[4-(cyclopropylsulfamoylamino)piperidin-1-yl]-N'-hydroxyethanimidamide (PubChem CID 104978488) has the molecular formula C10H21N5O3S and a molecular weight of 291.38 g/mol. Its IUPAC name is 2-[4-(cyclopropylsulfamoylamino)piperidin-1-yl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[4-(cyclopropylsulfamoylamino)piperidin-1-yl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 104978488 |
| Molecular Formula | C10H21N5O3S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-[4-(cyclopropylsulfamoylamino)piperidin-1-yl]-N'-hydroxyethanimidamide |
| SMILES | NC(CN1CCC(NS(=O)(=O)NC2CC2)CC1)=NO |
| InChI | InChI=1S/C10H21N5O3S/c11-10(12-16)7-15-5-3-9(4-6-15)14-19(17,18)13-8-1-2-8/h8-9,13-14,16H,1-7H2,(H2,11,12) |
| InChIKey | WNKQDTTWGFZBNJ-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 120.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|