C15H28N4O2 — CID 77115236
N-[1-(2-amino-2-hydroxyiminoethyl)piperidin-4-yl]-2,2,3,3-tetramethylcyclopropane-1-carboxamide (PubChem CID 77115236) has the molecular formula C15H28N4O2 and a molecular weight of 296.42 g/mol. Its IUPAC name is N-[1-(2-amino-2-hydroxyiminoethyl)piperidin-4-yl]-2,2,3,3-tetramethylcyclopropane-1-carboxamide.
| Compound Name | N-[1-(2-amino-2-hydroxyiminoethyl)piperidin-4-yl]-2,2,3,3-tetramethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 77115236 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | N-[1-(2-amino-2-hydroxyiminoethyl)piperidin-4-yl]-2,2,3,3-tetramethylcyclopropane-1-carboxamide |
| SMILES | CC1(C)C(C(=O)NC2CCN(CC(N)=NO)CC2)C1(C)C |
| InChI | InChI=1S/C15H28N4O2/c1-14(2)12(15(14,3)4)13(20)17-10-5-7-19(8-6-10)9-11(16)18-21/h10,12,21H,5-9H2,1-4H3,(H2,16,18)(H,17,20) |
| InChIKey | DCGKIMXWELRGFE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|