C10H18F3N5O2 — CID 104858961
1-[1-(2-amino-2-hydroxyiminoethyl)piperidin-4-yl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 104858961) has the molecular formula C10H18F3N5O2 and a molecular weight of 297.28 g/mol. Its IUPAC name is 1-[1-(2-amino-2-hydroxyiminoethyl)piperidin-4-yl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[1-(2-amino-2-hydroxyiminoethyl)piperidin-4-yl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 104858961 |
| Molecular Formula | C10H18F3N5O2 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 1-[1-(2-amino-2-hydroxyiminoethyl)piperidin-4-yl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | NC(CN1CCC(NC(=O)NCC(F)(F)F)CC1)=NO |
| InChI | InChI=1S/C10H18F3N5O2/c11-10(12,13)6-15-9(19)16-7-1-3-18(4-2-7)5-8(14)17-20/h7,20H,1-6H2,(H2,14,17)(H2,15,16,19) |
| InChIKey | IDCWYBKXXJNETP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|